C27H24N2O5S — CID 3876388
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate (PubChem CID 3876388) has the molecular formula C27H24N2O5S and a molecular weight of 488.57 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate |
|---|---|
| PubChem CID | 3876388 |
| Molecular Formula | C27H24N2O5S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSc1ccc2c3c(cccc13)C(=O)c1ccccc1-2)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C27H24N2O5S/c30-23(29-27(33)28-16-6-1-2-7-16)14-34-24(31)15-35-22-13-12-18-17-8-3-4-9-19(17)26(32)21-11-5-10-20(22)25(18)21/h3-5,8-13,16H,1-2,6-7,14-15H2,(H2,28,29,30,33) |
| InChIKey | GXRSFFIFBWOZGM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |