C29H31NO4S — CID 3387399
[2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate (PubChem CID 3387399) has the molecular formula C29H31NO4S and a molecular weight of 489.64 g/mol. Its IUPAC name is [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate.
| Compound Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate |
|---|---|
| PubChem CID | 3387399 |
| Molecular Formula | C29H31NO4S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate |
| SMILES | CC(C)CN(CC(C)C)C(=O)COC(=O)CSc1ccc2c3c(cccc13)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C29H31NO4S/c1-18(2)14-30(15-19(3)4)26(31)16-34-27(32)17-35-25-13-12-21-20-8-5-6-9-22(20)29(33)24-11-7-10-23(25)28(21)24/h5-13,18-19H,14-17H2,1-4H3 |
| InChIKey | QEMNUVKZDPIXOK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |