C26H24N2O5S — CID 3889780
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate (PubChem CID 3889780) has the molecular formula C26H24N2O5S and a molecular weight of 476.55 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate |
|---|---|
| PubChem CID | 3889780 |
| Molecular Formula | C26H24N2O5S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate |
| SMILES | CC(C)(C)NC(=O)NC(=O)COC(=O)CSc1ccc2c3c(cccc13)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C26H24N2O5S/c1-26(2,3)28-25(32)27-21(29)13-33-22(30)14-34-20-12-11-16-15-7-4-5-8-17(15)24(31)19-10-6-9-18(20)23(16)19/h4-12H,13-14H2,1-3H3,(H2,27,28,29,32) |
| InChIKey | QNAWUUGNWREZRP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |