C22H19ClFN3O2S — CID 4056687
3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-1-(3-chloro-4-fluorophenyl)pyrrolidine-2,5-dione (PubChem CID 4056687) has the molecular formula C22H19ClFN3O2S and a molecular weight of 443.93 g/mol. Its IUPAC name is 3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-1-(3-chloro-4-fluorophenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-1-(3-chloro-4-fluorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4056687 |
| Molecular Formula | C22H19ClFN3O2S |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-1-(3-chloro-4-fluorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCC(c3nc4ccccc4s3)CC2)C(=O)N1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C22H19ClFN3O2S/c23-15-11-14(5-6-16(15)24)27-20(28)12-18(22(27)29)26-9-7-13(8-10-26)21-25-17-3-1-2-4-19(17)30-21/h1-6,11,13,18H,7-10,12H2 |
| InChIKey | JUXDLVAYKRZNHF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|