C42H55F2NO5 — CID 4060826
ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate (PubChem CID 4060826) has the molecular formula C42H55F2NO5 and a molecular weight of 691.90 g/mol. Its IUPAC name is ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate.
| Compound Name | ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate |
|---|---|
| PubChem CID | 4060826 |
| Molecular Formula | C42H55F2NO5 |
| Molecular Weight | 691.90 g/mol |
| Exact Mass | 691.40 |
| IUPAC Name | ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]carbamate |
| SMILES | CCOC(=O)N(CC1CCC2CC1C2(C)C)CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(F)c(F)c3)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C42H55F2NO5/c1-6-50-39(48)45(24-29-11-13-30-23-35(29)40(30,3)4)25-42(49)19-17-34-32-15-10-27(20-31(46)14-9-26(2)8-7-18-41(34,42)5)21-33(32)38(47)28-12-16-36(43)37(44)22-28/h8,10,12,15-16,21-22,29-31,34-35,46,49H,6-7,9,11,13-14,17-20,23-25H2,1-5H3 |
| InChIKey | DQEDXJOOTSQWRR-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.90 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|