C17H11Cl2N3OS — CID 40646819
N-(3,4-dichlorophenyl)-2-(pyridin-2-ylmethylideneamino)thiophene-3-carboxamide (PubChem CID 40646819) has the molecular formula C17H11Cl2N3OS and a molecular weight of 376.27 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-(pyridin-2-ylmethylideneamino)thiophene-3-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-(pyridin-2-ylmethylideneamino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 40646819 |
| Molecular Formula | C17H11Cl2N3OS |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-(pyridin-2-ylmethylideneamino)thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1ccsc1N=Cc1ccccn1 |
| InChI | InChI=1S/C17H11Cl2N3OS/c18-14-5-4-11(9-15(14)19)22-16(23)13-6-8-24-17(13)21-10-12-3-1-2-7-20-12/h1-10H,(H,22,23) |
| InChIKey | PTRTZSJBVKUXTE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|