C33H51NO5S — CID 4091579
N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-propylmethanesulfonamide (PubChem CID 4091579) has the molecular formula C33H51NO5S and a molecular weight of 573.84 g/mol. Its IUPAC name is N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-propylmethanesulfonamide.
| Compound Name | N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-propylmethanesulfonamide |
|---|---|
| PubChem CID | 4091579 |
| Molecular Formula | C33H51NO5S |
| Molecular Weight | 573.84 g/mol |
| Exact Mass | 573.35 |
| IUPAC Name | N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-propylmethanesulfonamide |
| SMILES | CCCN(CC1(O)CCC2C34C=CC5(C=C3C(=O)C3CCCCC3)CC(O)CCC5(C)C4CCC21C)S(C)(=O)=O |
| InChI | InChI=1S/C33H51NO5S/c1-5-19-34(40(4,38)39)22-32(37)16-13-27-30(32,3)15-12-26-29(2)14-11-24(35)20-31(29)17-18-33(26,27)25(21-31)28(36)23-9-7-6-8-10-23/h17-18,21,23-24,26-27,35,37H,5-16,19-20,22H2,1-4H3 |
| InChIKey | RLYJVESBVACKEF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.84 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|