C43H65NO5 — CID 3701435
[5-[[1-adamantylmethyl(2,3-dihydroxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-cyclohexylmethanone (PubChem CID 3701435) has the molecular formula C43H65NO5 and a molecular weight of 675.99 g/mol. Its IUPAC name is [5-[[1-adamantylmethyl(2,3-dihydroxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-cyclohexylmethanone.
| Compound Name | [5-[[1-adamantylmethyl(2,3-dihydroxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 3701435 |
| Molecular Formula | C43H65NO5 |
| Molecular Weight | 675.99 g/mol |
| Exact Mass | 675.49 |
| IUPAC Name | [5-[[1-adamantylmethyl(2,3-dihydroxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-cyclohexylmethanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)C4CCCCC4)=C3)C2CCC2(C)C1CCC2(O)CN(CC(O)CO)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C43H65NO5/c1-38-11-8-32(46)22-41(38)14-15-43(34(23-41)37(48)31-6-4-3-5-7-31)35(38)9-12-39(2)36(43)10-13-42(39,49)27-44(24-33(47)25-45)26-40-19-28-16-29(20-40)18-30(17-28)21-40/h14-15,23,28-33,35-36,45-47,49H,3-13,16-22,24-27H2,1-2H3 |
| InChIKey | HTWKKSQTWPNZIH-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.99 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|