C37H57NO6 — CID 4102892
cyclohexyl-[5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 4102892) has the molecular formula C37H57NO6 and a molecular weight of 611.86 g/mol. Its IUPAC name is cyclohexyl-[5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 4102892 |
| Molecular Formula | C37H57NO6 |
| Molecular Weight | 611.86 g/mol |
| Exact Mass | 611.42 |
| IUPAC Name | cyclohexyl-[5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)C4CCCCC4)=C3)C2CCC2(C)C1CCC2(O)CN(CC(O)CO)CC1CCCO1 |
| InChI | InChI=1S/C37H57NO6/c1-33-13-10-26(40)19-35(33)16-17-37(29(20-35)32(42)25-7-4-3-5-8-25)30(33)11-14-34(2)31(37)12-15-36(34,43)24-38(21-27(41)23-39)22-28-9-6-18-44-28/h16-17,20,25-28,30-31,39-41,43H,3-15,18-19,21-24H2,1-2H3 |
| InChIKey | UAXZYLUCTMYJPV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.86 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|