C35H45ClFNO3 — CID 4096128
2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone (PubChem CID 4096128) has the molecular formula C35H45ClFNO3 and a molecular weight of 582.20 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone |
|---|---|
| PubChem CID | 4096128 |
| Molecular Formula | C35H45ClFNO3 |
| Molecular Weight | 582.20 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)Cc4c(F)cccc4Cl)=C3)C2CCC2(C)C1CCC2(O)CN1CCCCC1 |
| InChI | InChI=1S/C35H45ClFNO3/c1-31-12-9-23(39)20-33(31)15-16-35(25(21-33)28(40)19-24-26(36)7-6-8-27(24)37)29(31)10-13-32(2)30(35)11-14-34(32,41)22-38-17-4-3-5-18-38/h6-8,15-16,21,23,29-30,39,41H,3-5,9-14,17-20,22H2,1-2H3 |
| InChIKey | MDOGSIHFENZWDP-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.20 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|