C13H15N5O2S2 — CID 42173132
4-(6-acetamidopyridazin-3-yl)sulfanyl-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 42173132) has the molecular formula C13H15N5O2S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is 4-(6-acetamidopyridazin-3-yl)sulfanyl-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(6-acetamidopyridazin-3-yl)sulfanyl-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 42173132 |
| Molecular Formula | C13H15N5O2S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 4-(6-acetamidopyridazin-3-yl)sulfanyl-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | CC(=O)Nc1ccc(SCCCC(=O)Nc2nccs2)nn1 |
| InChI | InChI=1S/C13H15N5O2S2/c1-9(19)15-10-4-5-12(18-17-10)21-7-2-3-11(20)16-13-14-6-8-22-13/h4-6,8H,2-3,7H2,1H3,(H,14,16,20)(H,15,17,19) |
| InChIKey | PEWZFSBQMGPJFU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|