C26H30O6S — CID 42598085
(2R,3R,4R)-2-(4-methylphenyl)sulfonyl-3,5-bis(phenylmethoxy)pentane-1,4-diol (PubChem CID 42598085) has the molecular formula C26H30O6S and a molecular weight of 470.59 g/mol. Its IUPAC name is (2R,3R,4R)-2-(4-methylphenyl)sulfonyl-3,5-bis(phenylmethoxy)pentane-1,4-diol.
| Compound Name | (2R,3R,4R)-2-(4-methylphenyl)sulfonyl-3,5-bis(phenylmethoxy)pentane-1,4-diol |
|---|---|
| PubChem CID | 42598085 |
| Molecular Formula | C26H30O6S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (2R,3R,4R)-2-(4-methylphenyl)sulfonyl-3,5-bis(phenylmethoxy)pentane-1,4-diol |
| SMILES | Cc1ccc(S(=O)(=O)[C@H](CO)[C@H](OCc2ccccc2)[C@H](O)COCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H30O6S/c1-20-12-14-23(15-13-20)33(29,30)25(16-27)26(32-18-22-10-6-3-7-11-22)24(28)19-31-17-21-8-4-2-5-9-21/h2-15,24-28H,16-19H2,1H3/t24-,25-,26-/m1/s1 |
| InChIKey | QHJJTYOWCXRJHX-TWJOJJKGSA-N |
| XLogP | 3.29 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |