C10H16AlN — CID 42598335
4-dimethylalumanyl-N,N-dimethylaniline (PubChem CID 42598335) has the molecular formula C10H16AlN and a molecular weight of 177.23 g/mol. Its IUPAC name is 4-dimethylalumanyl-N,N-dimethylaniline.
| Compound Name | 4-dimethylalumanyl-N,N-dimethylaniline |
|---|---|
| PubChem CID | 42598335 |
| Molecular Formula | C10H16AlN |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | 4-dimethylalumanyl-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([Al](C)C)cc1 |
| InChI | InChI=1S/C8H10N.2CH3.Al/c1-9(2)8-6-4-3-5-7-8;;;/h4-7H,1-2H3;2*1H3; |
| InChIKey | OYZXTFRKQSRTTD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |