C9H12KN — CID 135081850
potassium 4-methanidyl-N,N-dimethylaniline (PubChem CID 135081850) has the molecular formula C9H12KN and a molecular weight of 173.30 g/mol. Its IUPAC name is potassium 4-methanidyl-N,N-dimethylaniline.
| Compound Name | potassium 4-methanidyl-N,N-dimethylaniline |
|---|---|
| PubChem CID | 135081850 |
| Molecular Formula | C9H12KN |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | potassium 4-methanidyl-N,N-dimethylaniline |
| SMILES | [CH2-]c1ccc(N(C)C)cc1.[K+] |
| InChI | InChI=1S/C9H12N.K/c1-8-4-6-9(7-5-8)10(2)3;/h4-7H,1H2,2-3H3;/q-1;+1 |
| InChIKey | KZLVNXZLXBBJOQ-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|