C19H16F2N2O3S — CID 42634516
1-[5-(2,5-difluorophenyl)-1,1-dioxospiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]ethanone (PubChem CID 42634516) has the molecular formula C19H16F2N2O3S and a molecular weight of 390.41 g/mol. Its IUPAC name is 1-[5-(2,5-difluorophenyl)-1,1-dioxospiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]ethanone.
| Compound Name | 1-[5-(2,5-difluorophenyl)-1,1-dioxospiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]ethanone |
|---|---|
| PubChem CID | 42634516 |
| Molecular Formula | C19H16F2N2O3S |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 1-[5-(2,5-difluorophenyl)-1,1-dioxospiro[1,3,4-thiadiazole-2,4'-2,3-dihydro-1H-naphthalene]-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2cc(F)ccc2F)S(=O)(=O)C12CCCc1ccccc12 |
| InChI | InChI=1S/C19H16F2N2O3S/c1-12(24)23-19(10-4-6-13-5-2-3-7-16(13)19)27(25,26)18(22-23)15-11-14(20)8-9-17(15)21/h2-3,5,7-9,11H,4,6,10H2,1H3 |
| InChIKey | ZPLNRMQFQBRNAV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |