C27H33ClN2O2 — CID 4276965
2-[(2-chloroacetyl)-(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-N-cyclohexyl-2-(4-methylphenyl)acetamide (PubChem CID 4276965) has the molecular formula C27H33ClN2O2 and a molecular weight of 453.03 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-N-cyclohexyl-2-(4-methylphenyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-N-cyclohexyl-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4276965 |
| Molecular Formula | C27H33ClN2O2 |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 2-[(2-chloroacetyl)-(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-N-cyclohexyl-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(C(C(=O)NC2CCCCC2)N(C(=O)CCl)C2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C27H33ClN2O2/c1-19-14-16-21(17-15-19)26(27(32)29-22-10-3-2-4-11-22)30(25(31)18-28)24-13-7-9-20-8-5-6-12-23(20)24/h5-6,8,12,14-17,22,24,26H,2-4,7,9-11,13,18H2,1H3,(H,29,32) |
| InChIKey | BNQJRISAGVIZCC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|