C16H24N2O2 — CID 4280756
[4-(hydroxyamino)-2,2,6,6-tetramethyl-1,3-dihydropyridin-3-yl]-phenylmethanol (PubChem CID 4280756) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is [4-(hydroxyamino)-2,2,6,6-tetramethyl-1,3-dihydropyridin-3-yl]-phenylmethanol.
| Compound Name | [4-(hydroxyamino)-2,2,6,6-tetramethyl-1,3-dihydropyridin-3-yl]-phenylmethanol |
|---|---|
| PubChem CID | 4280756 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | [4-(hydroxyamino)-2,2,6,6-tetramethyl-1,3-dihydropyridin-3-yl]-phenylmethanol |
| SMILES | CC1(C)C=C(NO)C(C(O)c2ccccc2)C(C)(C)N1 |
| InChI | InChI=1S/C16H24N2O2/c1-15(2)10-12(17-20)13(16(3,4)18-15)14(19)11-8-6-5-7-9-11/h5-10,13-14,17-20H,1-4H3 |
| InChIKey | QISHPINIPGRAIC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|