C16H17NOS — CID 42962003
1-[2-(benzenesulfinyl)ethyl]-2,3-dihydroindole (PubChem CID 42962003) has the molecular formula C16H17NOS and a molecular weight of 271.38 g/mol. Its IUPAC name is 1-[2-(benzenesulfinyl)ethyl]-2,3-dihydroindole.
| Compound Name | 1-[2-(benzenesulfinyl)ethyl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 42962003 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-[2-(benzenesulfinyl)ethyl]-2,3-dihydroindole |
| SMILES | O=S(CCN1CCc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C16H17NOS/c18-19(15-7-2-1-3-8-15)13-12-17-11-10-14-6-4-5-9-16(14)17/h1-9H,10-13H2 |
| InChIKey | ICUKRPLVUHITCB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |