C21H23N3O6S2 — CID 43017804
3-(2,3-dihydroindol-1-ylsulfonyl)-N'-[2-(1,1-dioxothiolan-3-yl)acetyl]benzohydrazide (PubChem CID 43017804) has the molecular formula C21H23N3O6S2 and a molecular weight of 477.56 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylsulfonyl)-N'-[2-(1,1-dioxothiolan-3-yl)acetyl]benzohydrazide.
| Compound Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N'-[2-(1,1-dioxothiolan-3-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 43017804 |
| Molecular Formula | C21H23N3O6S2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N'-[2-(1,1-dioxothiolan-3-yl)acetyl]benzohydrazide |
| SMILES | O=C(CC1CCS(=O)(=O)C1)NNC(=O)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C21H23N3O6S2/c25-20(12-15-9-11-31(27,28)14-15)22-23-21(26)17-5-3-6-18(13-17)32(29,30)24-10-8-16-4-1-2-7-19(16)24/h1-7,13,15H,8-12,14H2,(H,22,25)(H,23,26) |
| InChIKey | HZMUZAPKOUCANZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|