C23H20N4O7S — CID 26242015
3-(2,3-dihydroindol-1-ylsulfonyl)-N'-[2-(2-nitrophenoxy)acetyl]benzohydrazide (PubChem CID 26242015) has the molecular formula C23H20N4O7S and a molecular weight of 496.50 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylsulfonyl)-N'-[2-(2-nitrophenoxy)acetyl]benzohydrazide.
| Compound Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N'-[2-(2-nitrophenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 26242015 |
| Molecular Formula | C23H20N4O7S |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N'-[2-(2-nitrophenoxy)acetyl]benzohydrazide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])NNC(=O)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C23H20N4O7S/c28-22(15-34-21-11-4-3-10-20(21)27(30)31)24-25-23(29)17-7-5-8-18(14-17)35(32,33)26-13-12-16-6-1-2-9-19(16)26/h1-11,14H,12-13,15H2,(H,24,28)(H,25,29) |
| InChIKey | RMHNEBGBCRCCNR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|