C21H15N3O3S — CID 43048186
3,6-dimethyl-4-oxo-N-[3-(2-thiophen-2-ylethynyl)phenyl]furo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 43048186) has the molecular formula C21H15N3O3S and a molecular weight of 389.44 g/mol. Its IUPAC name is 3,6-dimethyl-4-oxo-N-[3-(2-thiophen-2-ylethynyl)phenyl]furo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 3,6-dimethyl-4-oxo-N-[3-(2-thiophen-2-ylethynyl)phenyl]furo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 43048186 |
| Molecular Formula | C21H15N3O3S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 3,6-dimethyl-4-oxo-N-[3-(2-thiophen-2-ylethynyl)phenyl]furo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1oc2ncn(C)c(=O)c2c1C(=O)Nc1cccc(C#Cc2cccs2)c1 |
| InChI | InChI=1S/C21H15N3O3S/c1-13-17(18-20(27-13)22-12-24(2)21(18)26)19(25)23-15-6-3-5-14(11-15)8-9-16-7-4-10-28-16/h3-7,10-12H,1-2H3,(H,23,25) |
| InChIKey | QYZJINSLPYKPLX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|