C13H20FN3O2S — CID 43604955
N-(5-amino-2-fluorophenyl)-3,5-dimethylpiperidine-1-sulfonamide (PubChem CID 43604955) has the molecular formula C13H20FN3O2S and a molecular weight of 301.39 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)-3,5-dimethylpiperidine-1-sulfonamide.
| Compound Name | N-(5-amino-2-fluorophenyl)-3,5-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 43604955 |
| Molecular Formula | C13H20FN3O2S |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)-3,5-dimethylpiperidine-1-sulfonamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)Nc2cc(N)ccc2F)C1 |
| InChI | InChI=1S/C13H20FN3O2S/c1-9-5-10(2)8-17(7-9)20(18,19)16-13-6-11(15)3-4-12(13)14/h3-4,6,9-10,16H,5,7-8,15H2,1-2H3 |
| InChIKey | WHGDTYYFXHSTTF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|