C13H24ClNO5S — CID 43827660
(1-chloro-4-propoxybutan-2-yl) N-[(1,1-dioxothiolan-3-yl)methyl]carbamate (PubChem CID 43827660) has the molecular formula C13H24ClNO5S and a molecular weight of 341.86 g/mol. Its IUPAC name is (1-chloro-4-propoxybutan-2-yl) N-[(1,1-dioxothiolan-3-yl)methyl]carbamate.
| Compound Name | (1-chloro-4-propoxybutan-2-yl) N-[(1,1-dioxothiolan-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 43827660 |
| Molecular Formula | C13H24ClNO5S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (1-chloro-4-propoxybutan-2-yl) N-[(1,1-dioxothiolan-3-yl)methyl]carbamate |
| SMILES | CCCOCCC(CCl)OC(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H24ClNO5S/c1-2-5-19-6-3-12(8-14)20-13(16)15-9-11-4-7-21(17,18)10-11/h11-12H,2-10H2,1H3,(H,15,16) |
| InChIKey | FPECWYVCQLCTDY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|