About 10-Methylbenzo(a)pyrene
10-Methylbenzo(a)pyrene (PubChem CID 44392) has the molecular formula C21H14
and a molecular weight of 266.30 g/mol. Its IUPAC name is 10-methylbenzo[a]pyrene.
Molecular Properties
| Compound Name | 10-Methylbenzo(a)pyrene |
| PubChem CID | 44392 |
| Molecular Formula | C21H14 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 10-methylbenzo[a]pyrene |
| SMILES | CC1=C2C3=C4C(=CC2=CC=C1)C=CC5=C4C(=CC=C5)C=C3 |
| InChI | InChI=1S/C21H14/c1-13-4-2-7-16-12-17-9-8-14-5-3-6-15-10-11-18(19(13)16)21(17)20(14)15/h2-12H,1H3 |
| InChIKey | COOUMHVNORGIOH-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | 399 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 10-Methylbenzo(a)pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-Methylbenzo(a)pyrene?
The IUPAC name of 10-Methylbenzo(a)pyrene (CID 44392) is 10-methylbenzo[a]pyrene.
What is the SMILES notation for 10-Methylbenzo(a)pyrene?
The canonical SMILES for 10-Methylbenzo(a)pyrene is CC1=C2C3=C4C(=CC2=CC=C1)C=CC5=C4C(=CC=C5)C=C3.
What is the InChIKey of 10-Methylbenzo(a)pyrene?
The InChIKey is COOUMHVNORGIOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14/c1-13-4-2-7-16-12-17-9-8-14-5-3-6-15-10-11-18(19(13)16)21(17)20(14)15/h2-12H,1H3.
What are the key properties of 10-Methylbenzo(a)pyrene?
10-Methylbenzo(a)pyrene has a molecular weight of 266.30 g/mol, XLogP of 6.60, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10-Methylbenzo(a)pyrene is sourced from PubChem (CID 44392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).