C19H34O2Si — CID 44521363
(E,5S,6S)-4,6-dimethyl-5-tri(propan-2-yl)silyloxyoct-3-en-7-ynal (PubChem CID 44521363) has the molecular formula C19H34O2Si and a molecular weight of 322.56 g/mol. Its IUPAC name is (E,5S,6S)-4,6-dimethyl-5-tri(propan-2-yl)silyloxyoct-3-en-7-ynal.
| Compound Name | (E,5S,6S)-4,6-dimethyl-5-tri(propan-2-yl)silyloxyoct-3-en-7-ynal |
|---|---|
| PubChem CID | 44521363 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.56 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (E,5S,6S)-4,6-dimethyl-5-tri(propan-2-yl)silyloxyoct-3-en-7-ynal |
| SMILES | C#C[C@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)/C(C)=C/CC=O |
| InChI | InChI=1S/C19H34O2Si/c1-10-17(8)19(18(9)12-11-13-20)21-22(14(2)3,15(4)5)16(6)7/h1,12-17,19H,11H2,2-9H3/b18-12+/t17-,19-/m0/s1 |
| InChIKey | JCNSJYDCHSSARE-GDEFMPCUSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|