C24H44OSi — CID 10619575
tri(propan-2-yl)-[(3E,5R,6R,7E,9S)-3,5,7,9-tetramethylundeca-3,7-dien-1-yn-6-yl]oxysilane (PubChem CID 10619575) has the molecular formula C24H44OSi and a molecular weight of 376.70 g/mol. Its IUPAC name is tri(propan-2-yl)-[(3E,5R,6R,7E,9S)-3,5,7,9-tetramethylundeca-3,7-dien-1-yn-6-yl]oxysilane.
| Compound Name | tri(propan-2-yl)-[(3E,5R,6R,7E,9S)-3,5,7,9-tetramethylundeca-3,7-dien-1-yn-6-yl]oxysilane |
|---|---|
| PubChem CID | 10619575 |
| Molecular Formula | C24H44OSi |
| Molecular Weight | 376.70 g/mol |
| Exact Mass | 376.32 |
| IUPAC Name | tri(propan-2-yl)-[(3E,5R,6R,7E,9S)-3,5,7,9-tetramethylundeca-3,7-dien-1-yn-6-yl]oxysilane |
| SMILES | C#C/C(C)=C/[C@@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)/C(C)=C/[C@@H](C)CC |
| InChI | InChI=1S/C24H44OSi/c1-13-20(9)15-22(11)24(23(12)16-21(10)14-2)25-26(17(3)4,18(5)6)19(7)8/h1,15-19,21-22,24H,14H2,2-12H3/b20-15+,23-16+/t21-,22+,24+/m0/s1 |
| InChIKey | IGZSTDAXBODFCI-HMOJWLDESA-N |
| XLogP | 7.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.70 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|