C27H30N2O7Se — CID 44542583
[(7R,8R,9S)-8,9-diacetyloxy-1,3-bis(4-methylphenyl)-2-selanylidene-6-oxa-1,3-diazaspiro[4.4]nonan-7-yl]methyl acetate (PubChem CID 44542583) has the molecular formula C27H30N2O7Se and a molecular weight of 573.50 g/mol. Its IUPAC name is [(7R,8R,9S)-8,9-diacetyloxy-1,3-bis(4-methylphenyl)-2-selanylidene-6-oxa-1,3-diazaspiro[4.4]nonan-7-yl]methyl acetate.
| Compound Name | [(7R,8R,9S)-8,9-diacetyloxy-1,3-bis(4-methylphenyl)-2-selanylidene-6-oxa-1,3-diazaspiro[4.4]nonan-7-yl]methyl acetate |
|---|---|
| PubChem CID | 44542583 |
| Molecular Formula | C27H30N2O7Se |
| Molecular Weight | 573.50 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | [(7R,8R,9S)-8,9-diacetyloxy-1,3-bis(4-methylphenyl)-2-selanylidene-6-oxa-1,3-diazaspiro[4.4]nonan-7-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC2(CN(c3ccc(C)cc3)C(=[Se])N2c2ccc(C)cc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H30N2O7Se/c1-16-6-10-21(11-7-16)28-15-27(29(26(28)37)22-12-8-17(2)9-13-22)25(35-20(5)32)24(34-19(4)31)23(36-27)14-33-18(3)30/h6-13,23-25H,14-15H2,1-5H3/t23-,24-,25+,27?/m1/s1 |
| InChIKey | NTADZKBVPJDGKH-ZMZXHRNFSA-N |
| XLogP | 2.41 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|