C10H12N4OS — CID 44555899
[1-oxo-2-(pyridin-3-ylmethyl)-1,2-thiazolidin-1-ylidene]cyanamide (PubChem CID 44555899) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is [1-oxo-2-(pyridin-3-ylmethyl)-1,2-thiazolidin-1-ylidene]cyanamide.
| Compound Name | [1-oxo-2-(pyridin-3-ylmethyl)-1,2-thiazolidin-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 44555899 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [1-oxo-2-(pyridin-3-ylmethyl)-1,2-thiazolidin-1-ylidene]cyanamide |
| SMILES | N#CN=S1(=O)CCCN1Cc1cccnc1 |
| InChI | InChI=1S/C10H12N4OS/c11-9-13-16(15)6-2-5-14(16)8-10-3-1-4-12-7-10/h1,3-4,7H,2,5-6,8H2 |
| InChIKey | RVFADARSFKGFSG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 69.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|