C26H44O2Sn — CID 44556658
(1R,2R,3R,6S,7S,8R,9R,11S,12R,13R,14S)-6-(tributylstannylmethyl)-4-oxahexacyclo[6.6.0.02,6.03,12.07,11.09,13]tetradecan-14-ol (PubChem CID 44556658) has the molecular formula C26H44O2Sn and a molecular weight of 507.35 g/mol. Its IUPAC name is (1R,2R,3R,6S,7S,8R,9R,11S,12R,13R,14S)-6-(tributylstannylmethyl)-4-oxahexacyclo[6.6.0.02,6.03,12.07,11.09,13]tetradecan-14-ol.
| Compound Name | (1R,2R,3R,6S,7S,8R,9R,11S,12R,13R,14S)-6-(tributylstannylmethyl)-4-oxahexacyclo[6.6.0.02,6.03,12.07,11.09,13]tetradecan-14-ol |
|---|---|
| PubChem CID | 44556658 |
| Molecular Formula | C26H44O2Sn |
| Molecular Weight | 507.35 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (1R,2R,3R,6S,7S,8R,9R,11S,12R,13R,14S)-6-(tributylstannylmethyl)-4-oxahexacyclo[6.6.0.02,6.03,12.07,11.09,13]tetradecan-14-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)C[C@@]12CO[C@@H]3[C@H]4C5[C@H](O)[C@H]([C@H]6[C@@H]1[C@@H]4C[C@@H]56)[C@@H]32 |
| InChI | InChI=1S/C14H17O2.3C4H9.Sn/c1-14-3-16-13-8-5-2-4-6(10(5)14)9(11(13)14)12(15)7(4)8;3*1-3-4-2;/h4-13,15H,1-3H2;3*1,3-4H2,2H3;/t4-,5-,6+,7?,8-,9-,10+,11+,12+,13-,14-;;;;/m1..../s1 |
| InChIKey | DHFDPDJAIJNDNX-QMKQYKBISA-N |
| XLogP | 5.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.35 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |