(2-bromophenyl)phosphonous acid

C6H6BrO2P — CID 44604849

IUPAC(2-bromophenyl)phosphonous acid
SMILESOP(O)c1ccccc1Br
InChIInChI=1S/C6H6BrO2P/c7-5-3-1-2-4-6(5)10(8)9/h1-4,8-9H
InChIKeyGSUOBFJZHOWPPA-UHFFFAOYSA-N
MW220.99 g/mol
LogP1.37
Rot. Bonds1

About (2-bromophenyl)phosphonous acid

(2-bromophenyl)phosphonous acid (PubChem CID 44604849) has the molecular formula C6H6BrO2P and a molecular weight of 220.99 g/mol. Its IUPAC name is (2-bromophenyl)phosphonous acid.

Molecular Properties

Compound Name(2-bromophenyl)phosphonous acid
PubChem CID44604849
Molecular FormulaC6H6BrO2P
Molecular Weight220.99 g/mol
Exact Mass219.93
IUPAC Name(2-bromophenyl)phosphonous acid
SMILESOP(O)c1ccccc1Br
InChIInChI=1S/C6H6BrO2P/c7-5-3-1-2-4-6(5)10(8)9/h1-4,8-9H
InChIKeyGSUOBFJZHOWPPA-UHFFFAOYSA-N
XLogP1.37
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.99
LogP ≤ 51.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (2-bromophenyl)phosphonous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-bromophenyl)phosphonous acid?
The IUPAC name of (2-bromophenyl)phosphonous acid (CID 44604849) is (2-bromophenyl)phosphonous acid.
What is the SMILES notation for (2-bromophenyl)phosphonous acid?
The canonical SMILES for (2-bromophenyl)phosphonous acid is OP(O)c1ccccc1Br.
What is the InChIKey of (2-bromophenyl)phosphonous acid?
The InChIKey is GSUOBFJZHOWPPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrO2P/c7-5-3-1-2-4-6(5)10(8)9/h1-4,8-9H.
What are the key properties of (2-bromophenyl)phosphonous acid?
(2-bromophenyl)phosphonous acid has a molecular weight of 220.99 g/mol, XLogP of 1.37, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)phosphonous acid is sourced from PubChem (CID 44604849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).