C22H29NO2 — CID 44627854
(R)-cyclohexyl-[5-[(2S)-1-methylpyrrolidin-2-yl]furan-2-yl]-phenylmethanol (PubChem CID 44627854) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (R)-cyclohexyl-[5-[(2S)-1-methylpyrrolidin-2-yl]furan-2-yl]-phenylmethanol.
| Compound Name | (R)-cyclohexyl-[5-[(2S)-1-methylpyrrolidin-2-yl]furan-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 44627854 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (R)-cyclohexyl-[5-[(2S)-1-methylpyrrolidin-2-yl]furan-2-yl]-phenylmethanol |
| SMILES | CN1CCC[C@H]1c1ccc([C@](O)(c2ccccc2)C2CCCCC2)o1 |
| InChI | InChI=1S/C22H29NO2/c1-23-16-8-13-19(23)20-14-15-21(25-20)22(24,17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2,4-5,9-10,14-15,18-19,24H,3,6-8,11-13,16H2,1H3/t19-,22-/m0/s1 |
| InChIKey | MVNBPMNELMRFMU-UGKGYDQZSA-N |
| XLogP | 4.86 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |