C20H30N2O3S — CID 44631354
N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]oct-7-enyl]-N-methylbenzenesulfonamide (PubChem CID 44631354) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]oct-7-enyl]-N-methylbenzenesulfonamide.
| Compound Name | N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]oct-7-enyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 44631354 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | N-[5-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]oct-7-enyl]-N-methylbenzenesulfonamide |
| SMILES | C=CCC(CCCCN(C)S(=O)(=O)c1ccccc1)C1=N[C@H](CC)CO1 |
| InChI | InChI=1S/C20H30N2O3S/c1-4-11-17(20-21-18(5-2)16-25-20)12-9-10-15-22(3)26(23,24)19-13-7-6-8-14-19/h4,6-8,13-14,17-18H,1,5,9-12,15-16H2,2-3H3/t17?,18-/m1/s1 |
| InChIKey | XILUOQHQAMNFEY-QRWMCTBCSA-N |
| XLogP | 3.88 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|