C14H22N2O3 — CID 45040630
2,2,3,3,5,5,6,6-octadeuterio-1-[(2,3,4-trimethoxyphenyl)methyl]piperazine (PubChem CID 45040630) has the molecular formula C14H22N2O3 and a molecular weight of 274.39 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octadeuterio-1-[(2,3,4-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 2,2,3,3,5,5,6,6-octadeuterio-1-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 45040630 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octadeuterio-1-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
| SMILES | [2H]C1([2H])NC([2H])([2H])C([2H])([2H])N(Cc2ccc(OC)c(OC)c2OC)C1([2H])[2H] |
| InChI | InChI=1S/C14H22N2O3/c1-17-12-5-4-11(13(18-2)14(12)19-3)10-16-8-6-15-7-9-16/h4-5,15H,6-10H2,1-3H3/i6D2,7D2,8D2,9D2 |
| InChIKey | UHWVSEOVJBQKBE-COMRDEPKSA-N |
| XLogP | 1.12 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |