C6H12N4S — CID 45076311
(5-butan-2-yl-1,3,4-thiadiazol-2-yl)hydrazine (PubChem CID 45076311) has the molecular formula C6H12N4S and a molecular weight of 172.26 g/mol. Its IUPAC name is (5-butan-2-yl-1,3,4-thiadiazol-2-yl)hydrazine.
| Compound Name | (5-butan-2-yl-1,3,4-thiadiazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 45076311 |
| Molecular Formula | C6H12N4S |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | (5-butan-2-yl-1,3,4-thiadiazol-2-yl)hydrazine |
| SMILES | CCC(C)c1nnc(NN)s1 |
| InChI | InChI=1S/C6H12N4S/c1-3-4(2)5-9-10-6(8-7)11-5/h4H,3,7H2,1-2H3,(H,8,10) |
| InChIKey | AIJKRVDTHAGZPP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|