C25H28N4 — CID 45176811
2-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-1-(2-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 45176811) has the molecular formula C25H28N4 and a molecular weight of 384.53 g/mol. Its IUPAC name is 2-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-1-(2-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-1-(2-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 45176811 |
| Molecular Formula | C25H28N4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-1-(2-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCn1cc(CN2CCc3c([nH]c4ccccc34)C2c2ccccc2C)c(C)n1 |
| InChI | InChI=1S/C25H28N4/c1-4-29-16-19(18(3)27-29)15-28-14-13-22-21-11-7-8-12-23(21)26-24(22)25(28)20-10-6-5-9-17(20)2/h5-12,16,25-26H,4,13-15H2,1-3H3 |
| InChIKey | SURZUNTYSGYRFY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|