C28H24N2O5S — CID 4540239
methyl 4-[[3-[[1-(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoate (PubChem CID 4540239) has the molecular formula C28H24N2O5S and a molecular weight of 500.58 g/mol. Its IUPAC name is methyl 4-[[3-[[1-(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[3-[[1-(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 4540239 |
| Molecular Formula | C28H24N2O5S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | methyl 4-[[3-[[1-(3,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2cccc(C=C3C(=O)NC(=S)N(c4ccc(C)c(C)c4)C3=O)c2)cc1 |
| InChI | InChI=1S/C28H24N2O5S/c1-17-7-12-22(13-18(17)2)30-26(32)24(25(31)29-28(30)36)15-20-5-4-6-23(14-20)35-16-19-8-10-21(11-9-19)27(33)34-3/h4-15H,16H2,1-3H3,(H,29,31,36) |
| InChIKey | XROSXQXQRZUVRB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|