C23H25ClN2O4 — CID 4572569
[8-[(3-chlorophenyl)hydrazinylidene]-9-methyl-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,9,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] acetate (PubChem CID 4572569) has the molecular formula C23H25ClN2O4 and a molecular weight of 428.92 g/mol. Its IUPAC name is [8-[(3-chlorophenyl)hydrazinylidene]-9-methyl-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,9,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] acetate.
| Compound Name | [8-[(3-chlorophenyl)hydrazinylidene]-9-methyl-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,9,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] acetate |
|---|---|
| PubChem CID | 4572569 |
| Molecular Formula | C23H25ClN2O4 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [8-[(3-chlorophenyl)hydrazinylidene]-9-methyl-3,6-dimethylidene-2-oxo-3a,4,5,6a,7,9,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] acetate |
| SMILES | C=C1CC(OC(C)=O)C2C(=C)C(=O)OC2C2C(C)C(=NNc3cccc(Cl)c3)CC12 |
| InChI | InChI=1S/C23H25ClN2O4/c1-11-8-19(29-14(4)27)21-13(3)23(28)30-22(21)20-12(2)18(10-17(11)20)26-25-16-7-5-6-15(24)9-16/h5-7,9,12,17,19-22,25H,1,3,8,10H2,2,4H3 |
| InChIKey | DHQXESVJPSVSRB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|