About bis(N-amino-N-ethylcarbamodithioate);nickel(2+)
bis(N-amino-N-ethylcarbamodithioate);nickel(2+) (PubChem CID 4589381) has the molecular formula C6H14N4NiS4
and a molecular weight of 329.17 g/mol. Its IUPAC name is bis(N-amino-N-ethylcarbamodithioate);nickel(2+).
Molecular Properties
| Compound Name | bis(N-amino-N-ethylcarbamodithioate);nickel(2+) |
| PubChem CID | 4589381 |
| Molecular Formula | C6H14N4NiS4 |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | bis(N-amino-N-ethylcarbamodithioate);nickel(2+) |
| SMILES | CCN(N)C(=S)[S-].CCN(N)C(=S)[S-].[Ni+2] |
| InChI | InChI=1S/2C3H8N2S2.Ni/c2*1-2-5(4)3(6)7;/h2*2,4H2,1H3,(H,6,7);/q;;+2/p-2 |
| InChIKey | QRYDZXKVNPXINM-UHFFFAOYSA-L |
| XLogP | 0.03 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(N-amino-N-ethylcarbamodithioate);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-amino-N-ethylcarbamodithioate);nickel(2+)?
The IUPAC name of bis(N-amino-N-ethylcarbamodithioate);nickel(2+) (CID 4589381) is bis(N-amino-N-ethylcarbamodithioate);nickel(2+).
What is the SMILES notation for bis(N-amino-N-ethylcarbamodithioate);nickel(2+)?
The canonical SMILES for bis(N-amino-N-ethylcarbamodithioate);nickel(2+) is CCN(N)C(=S)[S-].CCN(N)C(=S)[S-].[Ni+2].
What is the InChIKey of bis(N-amino-N-ethylcarbamodithioate);nickel(2+)?
The InChIKey is QRYDZXKVNPXINM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H8N2S2.Ni/c2*1-2-5(4)3(6)7;/h2*2,4H2,1H3,(H,6,7);/q;;+2/p-2.
What are the key properties of bis(N-amino-N-ethylcarbamodithioate);nickel(2+)?
bis(N-amino-N-ethylcarbamodithioate);nickel(2+) has a molecular weight of 329.17 g/mol, XLogP of 0.03, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-amino-N-ethylcarbamodithioate);nickel(2+) is sourced from PubChem (CID 4589381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).