C24H17Cl2N3O3 — CID 46224935
4-amino-5-(3,5-dichlorobenzoyl)-2-(4-phenoxyphenyl)-1H-pyrrole-3-carboxamide (PubChem CID 46224935) has the molecular formula C24H17Cl2N3O3 and a molecular weight of 466.32 g/mol. Its IUPAC name is 4-amino-5-(3,5-dichlorobenzoyl)-2-(4-phenoxyphenyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 4-amino-5-(3,5-dichlorobenzoyl)-2-(4-phenoxyphenyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 46224935 |
| Molecular Formula | C24H17Cl2N3O3 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 4-amino-5-(3,5-dichlorobenzoyl)-2-(4-phenoxyphenyl)-1H-pyrrole-3-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(Oc3ccccc3)cc2)[nH]c(C(=O)c2cc(Cl)cc(Cl)c2)c1N |
| InChI | InChI=1S/C24H17Cl2N3O3/c25-15-10-14(11-16(26)12-15)23(30)22-20(27)19(24(28)31)21(29-22)13-6-8-18(9-7-13)32-17-4-2-1-3-5-17/h1-12,29H,27H2,(H2,28,31) |
| InChIKey | NYNVPRZTZIRTBL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |