C22H19ClN2O3S — CID 46256946
4-chloro-N-(2,4-dimethoxyphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide (PubChem CID 46256946) has the molecular formula C22H19ClN2O3S and a molecular weight of 426.93 g/mol. Its IUPAC name is 4-chloro-N-(2,4-dimethoxyphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-(2,4-dimethoxyphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 46256946 |
| Molecular Formula | C22H19ClN2O3S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 4-chloro-N-(2,4-dimethoxyphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide |
| SMILES | COc1ccc(N(C)C(=O)c2cc3c(Cl)nc4ccc(C)cc4c3s2)c(OC)c1 |
| InChI | InChI=1S/C22H19ClN2O3S/c1-12-5-7-16-14(9-12)20-15(21(23)24-16)11-19(29-20)22(26)25(2)17-8-6-13(27-3)10-18(17)28-4/h5-11H,1-4H3 |
| InChIKey | TVLVHGHYPWCVOX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|