C27H27N3OS — CID 46383060
N-(1-benzylpiperidin-4-yl)-2-methyl-8-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 46383060) has the molecular formula C27H27N3OS and a molecular weight of 441.60 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-methyl-8-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-methyl-8-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 46383060 |
| Molecular Formula | C27H27N3OS |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-methyl-8-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCN(Cc3ccccc3)CC2)c2cccc(-c3cccs3)c2n1 |
| InChI | InChI=1S/C27H27N3OS/c1-19-17-24(22-9-5-10-23(26(22)28-19)25-11-6-16-32-25)27(31)29-21-12-14-30(15-13-21)18-20-7-3-2-4-8-20/h2-11,16-17,21H,12-15,18H2,1H3,(H,29,31) |
| InChIKey | CRHRFWVVWCEEKU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |