C22H22ClNO6 — CID 46607840
[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 46607840) has the molecular formula C22H22ClNO6 and a molecular weight of 431.87 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46607840 |
| Molecular Formula | C22H22ClNO6 |
| Molecular Weight | 431.87 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | [2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NC2CCOc3ccccc32)cc(Cl)c1OC |
| InChI | InChI=1S/C22H22ClNO6/c1-27-19-12-14(11-16(23)22(19)28-2)7-8-21(26)30-13-20(25)24-17-9-10-29-18-6-4-3-5-15(17)18/h3-8,11-12,17H,9-10,13H2,1-2H3,(H,24,25)/b8-7+ |
| InChIKey | WVCOTJKFCXBLMH-BQYQJAHWSA-N |
| XLogP | 3.55 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|