C21H18Cl2N2O2 — CID 46665176
N-(4-amino-3,5-dichlorophenyl)-2-benzhydryloxyacetamide (PubChem CID 46665176) has the molecular formula C21H18Cl2N2O2 and a molecular weight of 401.29 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-benzhydryloxyacetamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-benzhydryloxyacetamide |
|---|---|
| PubChem CID | 46665176 |
| Molecular Formula | C21H18Cl2N2O2 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-benzhydryloxyacetamide |
| SMILES | Nc1c(Cl)cc(NC(=O)COC(c2ccccc2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H18Cl2N2O2/c22-17-11-16(12-18(23)20(17)24)25-19(26)13-27-21(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12,21H,13,24H2,(H,25,26) |
| InChIKey | NQLIIBZJLHAUQH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|