C21H22BrN2O4P — CID 4671751
(3-bromophenoxy)-tert-butyl-(5-methylfuran-2-yl)-(4-nitrophenyl)imino-lambda5-phosphane (PubChem CID 4671751) has the molecular formula C21H22BrN2O4P and a molecular weight of 477.30 g/mol. Its IUPAC name is (3-bromophenoxy)-tert-butyl-(5-methylfuran-2-yl)-(4-nitrophenyl)imino-lambda5-phosphane.
| Compound Name | (3-bromophenoxy)-tert-butyl-(5-methylfuran-2-yl)-(4-nitrophenyl)imino-lambda5-phosphane |
|---|---|
| PubChem CID | 4671751 |
| Molecular Formula | C21H22BrN2O4P |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | (3-bromophenoxy)-tert-butyl-(5-methylfuran-2-yl)-(4-nitrophenyl)imino-lambda5-phosphane |
| SMILES | Cc1ccc(P(=Nc2ccc([N+](=O)[O-])cc2)(Oc2cccc(Br)c2)C(C)(C)C)o1 |
| InChI | InChI=1S/C21H22BrN2O4P/c1-15-8-13-20(27-15)29(21(2,3)4,28-19-7-5-6-16(22)14-19)23-17-9-11-18(12-10-17)24(25)26/h5-14H,1-4H3 |
| InChIKey | ALURLYBSSRICBI-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 77.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|