C25H32N3O4P — CID 4829506
3-[tert-butyl-(5-methylfuran-2-yl)-(4-nitrophenyl)imino-λ5-phosphanyl]oxy-N,N-diethylaniline (PubChem CID 4829506) has the molecular formula C25H32N3O4P and a molecular weight of 469.52 g/mol. Its IUPAC name is 3-[tert-butyl-(5-methylfuran-2-yl)-(4-nitrophenyl)imino-λ5-phosphanyl]oxy-N,N-diethylaniline.
| Compound Name | 3-[tert-butyl-(5-methylfuran-2-yl)-(4-nitrophenyl)imino-λ5-phosphanyl]oxy-N,N-diethylaniline |
|---|---|
| PubChem CID | 4829506 |
| Molecular Formula | C25H32N3O4P |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 3-[tert-butyl-(5-methylfuran-2-yl)-(4-nitrophenyl)imino-λ5-phosphanyl]oxy-N,N-diethylaniline |
| SMILES | CCN(CC)c1cccc(OP(=Nc2ccc([N+](=O)[O-])cc2)(c2ccc(C)o2)C(C)(C)C)c1 |
| InChI | InChI=1S/C25H32N3O4P/c1-7-27(8-2)22-10-9-11-23(18-22)32-33(25(4,5)6,24-17-12-19(3)31-24)26-20-13-15-21(16-14-20)28(29)30/h9-18H,7-8H2,1-6H3 |
| InChIKey | PYWWXGLUFZCRKN-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 81.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|