C18H14Cl2N2O — CID 46834133
4-(3,4-dichlorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one (PubChem CID 46834133) has the molecular formula C18H14Cl2N2O and a molecular weight of 345.23 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one.
| Compound Name | 4-(3,4-dichlorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one |
|---|---|
| PubChem CID | 46834133 |
| Molecular Formula | C18H14Cl2N2O |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one |
| SMILES | O=C1NC2=C(CCc3ccccc32)C(c2ccc(Cl)c(Cl)c2)N1 |
| InChI | InChI=1S/C18H14Cl2N2O/c19-14-8-6-11(9-15(14)20)16-13-7-5-10-3-1-2-4-12(10)17(13)22-18(23)21-16/h1-4,6,8-9,16H,5,7H2,(H2,21,22,23) |
| InChIKey | ZURMVGLTRWVMKA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |