C20H28N2O5S — CID 46840850
5-[(2R)-1,1-dideuterio-2-[[1,1-dideuterio-2-[2,3,4,5-tetradeuterio-6-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]ethyl]amino]propyl]-2-(trideuteriomethoxy)benzenesulfonamide (PubChem CID 46840850) has the molecular formula C20H28N2O5S and a molecular weight of 424.62 g/mol. Its IUPAC name is 5-[(2R)-1,1-dideuterio-2-[[1,1-dideuterio-2-[2,3,4,5-tetradeuterio-6-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]ethyl]amino]propyl]-2-(trideuteriomethoxy)benzenesulfonamide.
| Compound Name | 5-[(2R)-1,1-dideuterio-2-[[1,1-dideuterio-2-[2,3,4,5-tetradeuterio-6-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]ethyl]amino]propyl]-2-(trideuteriomethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 46840850 |
| Molecular Formula | C20H28N2O5S |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 5-[(2R)-1,1-dideuterio-2-[[1,1-dideuterio-2-[2,3,4,5-tetradeuterio-6-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]ethyl]amino]propyl]-2-(trideuteriomethoxy)benzenesulfonamide |
| SMILES | [2H]c1c([2H])c([2H])c(OC([2H])([2H])C([2H])([2H])[2H])c(OCC([2H])([2H])N[C@H](C)C([2H])([2H])c2ccc(OC([2H])([2H])[2H])c(S(N)(=O)=O)c2)c1[2H] |
| InChI | InChI=1S/C20H28N2O5S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24)/t15-/m1/s1/i1D3,3D3,4D2,5D,6D,7D,8D,11D2,13D2 |
| InChIKey | DRHKJLXJIQTDTD-VQQYMGMRSA-N |
| XLogP | 2.34 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |