C17H15NO5 — CID 46843175
6,8-dimethoxy-3-(6-methoxy-3-pyridinyl)chromen-4-one (PubChem CID 46843175) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is 6,8-dimethoxy-3-(6-methoxy-3-pyridinyl)chromen-4-one.
| Compound Name | 6,8-dimethoxy-3-(6-methoxy-3-pyridinyl)chromen-4-one |
|---|---|
| PubChem CID | 46843175 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 6,8-dimethoxy-3-(6-methoxy-3-pyridinyl)chromen-4-one |
| SMILES | COc1cc(OC)c2occ(-c3ccc(OC)nc3)c(=O)c2c1 |
| InChI | InChI=1S/C17H15NO5/c1-20-11-6-12-16(19)13(9-23-17(12)14(7-11)21-2)10-4-5-15(22-3)18-8-10/h4-9H,1-3H3 |
| InChIKey | JSUKOJZALFDNOI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |