C29H30O6 — CID 46855383
(5S,7R,8R,9S)-6-ethyl-3-phenyl-8,9-bis(phenylmethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-ol (PubChem CID 46855383) has the molecular formula C29H30O6 and a molecular weight of 474.55 g/mol. Its IUPAC name is (5S,7R,8R,9S)-6-ethyl-3-phenyl-8,9-bis(phenylmethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-ol.
| Compound Name | (5S,7R,8R,9S)-6-ethyl-3-phenyl-8,9-bis(phenylmethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-ol |
|---|---|
| PubChem CID | 46855383 |
| Molecular Formula | C29H30O6 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | (5S,7R,8R,9S)-6-ethyl-3-phenyl-8,9-bis(phenylmethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-ol |
| SMILES | CCC1(O)[C@@H]2OC3(c4ccccc4)OC([C@H]2OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1O3 |
| InChI | InChI=1S/C29H30O6/c1-2-28(30)26-24(31-18-20-12-6-3-7-13-20)23-25(32-19-21-14-8-4-9-15-21)27(28)35-29(33-23,34-26)22-16-10-5-11-17-22/h3-17,23-27,30H,2,18-19H2,1H3/t23?,24-,25+,26-,27+,28?,29? |
| InChIKey | HDEFQKKABCEVDE-ZNZLBFGXSA-N |
| XLogP | 4.31 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |