C22H18FN3O5S — CID 4691781
[4-[[acetyl-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-3-acetyloxyphenyl] acetate (PubChem CID 4691781) has the molecular formula C22H18FN3O5S and a molecular weight of 455.47 g/mol. Its IUPAC name is [4-[[acetyl-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-3-acetyloxyphenyl] acetate.
| Compound Name | [4-[[acetyl-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-3-acetyloxyphenyl] acetate |
|---|---|
| PubChem CID | 4691781 |
| Molecular Formula | C22H18FN3O5S |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | [4-[[acetyl-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-3-acetyloxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C=NN(C(C)=O)c2nc(-c3ccc(F)cc3)cs2)c(OC(C)=O)c1 |
| InChI | InChI=1S/C22H18FN3O5S/c1-13(27)26(22-25-20(12-32-22)16-4-7-18(23)8-5-16)24-11-17-6-9-19(30-14(2)28)10-21(17)31-15(3)29/h4-12H,1-3H3 |
| InChIKey | UHWMRXRWDUVLLL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 98.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|